CAS 169383-17-9 appears in our catalog under these names: D-2-Nitrophenylalanine, 97%, (R)–2–Amino–3–(2–nitrophenyl)propanoic acid, D-2-Nitrophenylalanine, (R)-2-Amino-3-(2-nitrophenyl)propanoic acid, 97%, 97%, (R)-2-Amino-3-(2-nitrophenyl)propanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 500mg, 1000mg, 2000mg.
(2R)-2-amino-3-(2-nitrophenyl)propanoic acid (CAS 169383-17-9) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (2R)-2-amino-3-(2-nitrophenyl)propanoic acid. InChIKey: SDZGVFSSLGTJAJ-SSDOTTSWSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-nitrophenyl)propanoic acid |
| InChIKey | SDZGVFSSLGTJAJ-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)