Products 360779-31-3
CAS 360779-31-3 appears in our catalog under these names: Methyl-2-amino-2-(4-nitrophenyl) acetate, 95%, Methyl 2-amino-2-(4-nitrophenyl)acetate hydrochloride, 98%, methyl 2–amino–2–(4–nitrophenyl)acetate, methyl 2-amino-2-(4-nitrophenyl)acetate, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Methyl 2-amino-2-(4-nitrophenyl)acetate (CAS 360779-31-3) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: methyl 2-amino-2-(4-nitrophenyl)acetate. InChIKey: JQQJZFRFDFGUPU-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | methyl 2-amino-2-(4-nitrophenyl)acetate |
| InChIKey | JQQJZFRFDFGUPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)