CAS 756814-14-9 appears in our catalog under these names: (R)-3-(2-Nitrophenyl)-beta-alanine, 95%, (R)–3–Amino–3–(2–nitrophenyl)propanoic acid, H-D-β-Phe(2-NO2)-OH 98%, (R)-3-Amino-3-(2-nitrophenyl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(3R)-3-amino-3-(2-nitrophenyl)propanoic acid (CAS 756814-14-9) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (3R)-3-amino-3-(2-nitrophenyl)propanoic acid. InChIKey: XXBOYULKNZTOMN-SSDOTTSWSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (3R)-3-amino-3-(2-nitrophenyl)propanoic acid |
| InChIKey | XXBOYULKNZTOMN-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](CC(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)