Dimethyl 4-fluorophthalate, 95%
cas: 110706-50-8 — see every product listed under this CAS number, including other names
Dimethyl 4-fluorophthalate, 95% (CAS 110706-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A196364-250mg |
| cas | 110706-50-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 659.62 Pln | |
| Ambeed | 25g | 2717.75 Pln | |
| BLDpharm | 100mg | 164.41 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 275.48 Pln | |
| BLDpharm | 5g | 703.11 Pln | |
| BLDpharm | 25g | 2924.55 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Dimethyl 4-fluorobenzene-1,2-dicarboxylate (CAS 110706-50-8) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 4-fluorobenzene-1,2-dicarboxylate. InChIKey: UPXQAPWOMHKSBU-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 4-fluorobenzene-1,2-dicarboxylate |
| InChIKey | UPXQAPWOMHKSBU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)F)C(=O)OC |
Computed by PubChem (NCBI)