Products 1346498-50-7

CAS 1346498-50-7 is the registry number for 3-Fluoro-4-(oxetan-3-yloxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-fluoro-4-(oxetan-3-yloxy)benzoic acid (CAS 1346498-50-7) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: 3-fluoro-4-(oxetan-3-yloxy)benzoic acid. InChIKey: ASUVPHSYHHOVGC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9FO4
Molecular weight212.17 g/mol
IUPAC name3-fluoro-4-(oxetan-3-yloxy)benzoic acid
InChIKeyASUVPHSYHHOVGC-UHFFFAOYSA-N
SMILESC1C(CO1)OC2=C(C=C(C=C2)C(=O)O)F

Computed by PubChem (NCBI)