CAS 779-72-6 is the registry number for 1,3-dimethyl 4-fluorobenzene-1,3-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 4-fluorobenzene-1,3-dicarboxylate (CAS 779-72-6) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 4-fluorobenzene-1,3-dicarboxylate. InChIKey: WMJDJPJGAJARGR-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 4-fluorobenzene-1,3-dicarboxylate |
| InChIKey | WMJDJPJGAJARGR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)C(=O)OC |
Computed by PubChem (NCBI)