Products 1873368-59-2

CAS 1873368-59-2 is the registry number for 3-(5-Fluoro-2-methoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(5-fluoro-2-methoxyphenyl)-2-oxopropanoic acid (CAS 1873368-59-2) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: 3-(5-fluoro-2-methoxyphenyl)-2-oxopropanoic acid. InChIKey: FMZVMIKRTMHWKI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9FO4
Molecular weight212.17 g/mol
IUPAC name3-(5-fluoro-2-methoxyphenyl)-2-oxopropanoic acid
InChIKeyFMZVMIKRTMHWKI-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)F)CC(=O)C(=O)O

Computed by PubChem (NCBI)