CAS 1493985-60-6 is the registry number for 3-(3-Fluoro-4-methoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-fluoro-4-methoxyphenyl)-2-oxopropanoic acid (CAS 1493985-60-6) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: 3-(3-fluoro-4-methoxyphenyl)-2-oxopropanoic acid. InChIKey: QBRSGOATYLGFLT-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 3-(3-fluoro-4-methoxyphenyl)-2-oxopropanoic acid |
| InChIKey | QBRSGOATYLGFLT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC(=O)C(=O)O)F |
Computed by PubChem (NCBI)