CAS 110706-50-8 appears in our catalog under these names: Dimethy-4-fluorophthalate, 95%, Dimethyl 4-fluorophthalate, 95%, 95%, Dimethyl 4-fluorophthalate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g, 10g.
Dimethyl 4-fluorobenzene-1,2-dicarboxylate (CAS 110706-50-8) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 4-fluorobenzene-1,2-dicarboxylate. InChIKey: UPXQAPWOMHKSBU-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 4-fluorobenzene-1,2-dicarboxylate |
| InChIKey | UPXQAPWOMHKSBU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)F)C(=O)OC |
Computed by PubChem (NCBI)