cas: 13036-02-7 — see every product listed under this CAS number, including other names
Dimethyl 5-Hydroxyisophthalate, >98.0%(GC)(T) (CAS 13036-02-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H1007-25G |
| cas | 13036-02-7 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 177.35 Pln | |
| TCI | 250g | 1180.47 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Dimethyl 5-hydroxybenzene-1,3-dicarboxylate (CAS 13036-02-7) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 5-hydroxybenzene-1,3-dicarboxylate. InChIKey: DOSDTCPDBPRFHQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 5-hydroxybenzene-1,3-dicarboxylate |
| InChIKey | DOSDTCPDBPRFHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)O)C(=O)OC |
Computed by PubChem (NCBI)