cas: 13036-02-7 — see every product listed under this CAS number, including other names
Dimethyl 5-hydroxyisophthalate, 95% (CAS 13036-02-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225665-10G |
| cas | 13036-02-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 289.50 Pln | |
| Fluorochem | 500g | 1127.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl 5-hydroxybenzene-1,3-dicarboxylate (CAS 13036-02-7) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 5-hydroxybenzene-1,3-dicarboxylate. InChIKey: DOSDTCPDBPRFHQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 5-hydroxybenzene-1,3-dicarboxylate |
| InChIKey | DOSDTCPDBPRFHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)O)C(=O)OC |
Computed by PubChem (NCBI)