cas: 13036-02-7 — see every product listed under this CAS number, including other names
Dimethyl 5-hydroxyisophthalate, 99% (CAS 13036-02-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 356440100 |
| cas | 13036-02-7 |
| size | 10g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 10g | 185.75 Pln | |
| Thermo Scientific (Acros) | 25g | 368.83 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
Dimethyl 5-hydroxybenzene-1,3-dicarboxylate (CAS 13036-02-7) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 5-hydroxybenzene-1,3-dicarboxylate. InChIKey: DOSDTCPDBPRFHQ-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 5-hydroxybenzene-1,3-dicarboxylate |
| InChIKey | DOSDTCPDBPRFHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)O)C(=O)OC |
Computed by PubChem (NCBI)