CAS 1189570-18-0 appears in our catalog under these names: Dimethyl 6-Chloropyridine-3,4-dicarboxylate, 95+%, 95+%, Dimethyl 6-chloropyridine-3,4-dicarboxylate, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Dimethyl 6-chloropyridine-3,4-dicarboxylate (CAS 1189570-18-0) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: dimethyl 6-chloropyridine-3,4-dicarboxylate. InChIKey: NSWPCJMUZAKVFD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | dimethyl 6-chloropyridine-3,4-dicarboxylate |
| InChIKey | NSWPCJMUZAKVFD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1C(=O)OC)Cl |
Computed by PubChem (NCBI)