Products 34907-53-4
CAS 34907-53-4 appears in our catalog under these names: 2·4·6–Methyltrimethylbenzeneborate, Dimethoxy(2,4,6-trimethylphenyl)borane, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg.
Dimethoxy-(2,4,6-trimethylphenyl)borane (CAS 34907-53-4) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: dimethoxy-(2,4,6-trimethylphenyl)borane. InChIKey: NCEUIABFEQHUQB-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | dimethoxy-(2,4,6-trimethylphenyl)borane |
| InChIKey | NCEUIABFEQHUQB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C)C)(OC)OC |
Computed by PubChem (NCBI)