CAS 953075-90-6 appears in our catalog under these names: (2,6-Diethyl-4-methylphenyl)boronic acid, 95%, (2,6-Diethyl-4-methylphenyl)boronic acid, 97%, 97%, (2,6-Diethyl-4-methylphenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
(2,6-diethyl-4-methylphenyl)boronic acid (CAS 953075-90-6) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: (2,6-diethyl-4-methylphenyl)boronic acid. InChIKey: RJIQZLJNCMHCCN-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | (2,6-diethyl-4-methylphenyl)boronic acid |
| InChIKey | RJIQZLJNCMHCCN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1CC)C)CC)(O)O |
Computed by PubChem (NCBI)