Products 953075-90-6

CAS 953075-90-6 appears in our catalog under these names: (2,6-Diethyl-4-methylphenyl)boronic acid, 95%, (2,6-Diethyl-4-methylphenyl)boronic acid, 97%, 97%, (2,6-Diethyl-4-methylphenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,6-diethyl-4-methylphenyl)boronic acid (CAS 953075-90-6) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: (2,6-diethyl-4-methylphenyl)boronic acid. InChIKey: RJIQZLJNCMHCCN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17BO2
Molecular weight192.06 g/mol
IUPAC name(2,6-diethyl-4-methylphenyl)boronic acid
InChIKeyRJIQZLJNCMHCCN-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1CC)C)CC)(O)O

Computed by PubChem (NCBI)