CAS 2225155-45-1 is the registry number for 3–Methyl–5–(iso–butyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3-methyl-5-(2-methylpropyl)phenyl]boronic acid (CAS 2225155-45-1) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: [3-methyl-5-(2-methylpropyl)phenyl]boronic acid. InChIKey: ADNLHTQQQKNVRV-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | [3-methyl-5-(2-methylpropyl)phenyl]boronic acid |
| InChIKey | ADNLHTQQQKNVRV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)CC(C)C)C)(O)O |
Computed by PubChem (NCBI)