cas: 881-86-7 — see every product listed under this CAS number, including other names
Dimethyl pyridine-2,5-dicarboxylate, 98%, 98% (CAS 881-86-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PMJ-50g |
| cas | 881-86-7 |
| size | 50g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 251.60 Pln | |
| Chemat | 250g | 957.20 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 438.80 Pln | |
| Chemat | 500g | 1852.80 Pln | |
| Chemat | 1kg | 3285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl pyridine-2,5-dicarboxylate (CAS 881-86-7) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: dimethyl pyridine-2,5-dicarboxylate. InChIKey: TUGSJNQAIMFEDY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | dimethyl pyridine-2,5-dicarboxylate |
| InChIKey | TUGSJNQAIMFEDY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)