cas: 1796-83-4 — see every product listed under this CAS number, including other names
Dimethyl pyridine-3,4-dicarboxylate, 96%, 96% (CAS 1796-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11385M-100mg |
| cas | 1796-83-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 1091.60 Pln | |
| Chemat | 10g | 1941.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Dimethyl pyridine-3,4-dicarboxylate (CAS 1796-83-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: dimethyl pyridine-3,4-dicarboxylate. InChIKey: AUQUSBAFIHOGHK-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | dimethyl pyridine-3,4-dicarboxylate |
| InChIKey | AUQUSBAFIHOGHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC=C1)C(=O)OC |
Computed by PubChem (NCBI)