cas: 886-38-4 — see every product listed under this CAS number, including other names
Diphenylcyclopropenone, 98% (CAS 886-38-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Ambeed.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 175820010 |
| cas | 886-38-4 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 278.40 Pln | |
| Thermo Scientific (Acros) | 5g | 913.16 Pln | |
| Thermo Scientific (Acros) | 25g | 4058.00 Pln | |
| Sigma-Aldrich | 1G | 426.00 Pln | |
| Sigma-Aldrich | 5G | 1480.00 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 431.56 Pln | |
| Ambeed | 25g | 1482.88 Pln | |
| Ambeed | 100g | 5682.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Diphenylcyclopropenone is a cyclopropenone compound having phenyl substituents at the 2- and 3-positions. It has a role as a photosensitizing agent, a hapten and a drug allergen.
Source: ChEBI
| Molecular formula | C15H10O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2,3-diphenylcycloprop-2-en-1-one |
| InChIKey | HCIBTBXNLVOFER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)