Products 886-38-4
CAS 886-38-4 appears in our catalog under these names: Diphenylcyclopropenone, Diphenylcyclopropenone/ 99.9%, Diphenylcyclopropenone/ 98%, Diphencyprone, 2,3-Diphenyl-2-cyclopropen-1-one, 99% (dry wt.), may cont up. Offered by: Mikromol, LoGiCal, TargetMol, Chemat, GLPBio. Available pack sizes: 100mg, 10mg, 500mg, 1g, 5g, 10mM (in 1ml dmso), 25g, 10g.
Diphenylcyclopropenone is a cyclopropenone compound having phenyl substituents at the 2- and 3-positions. It has a role as a photosensitizing agent, a hapten and a drug allergen.
Source: ChEBI
| Molecular formula | C15H10O |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2,3-diphenylcycloprop-2-en-1-one |
| InChIKey | HCIBTBXNLVOFER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)