cas: 7695-56-9 — see every product listed under this CAS number, including other names
Dl-threo-3-phenylserine, ≥95%, ≥95% (CAS 7695-56-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3G6-1g |
| cas | 7695-56-9 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1379.60 Pln | |
| Chemat | 5g | 3861.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-2-amino-3-hydroxy-3-phenylpropanoic acid (CAS 7695-56-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-3-phenylpropanoic acid. InChIKey: VHVGNTVUSQUXPS-JGVFFNPUSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-3-phenylpropanoic acid |
| InChIKey | VHVGNTVUSQUXPS-JGVFFNPUSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)