CAS 1078-17-7 appears in our catalog under these names: DL–beta–Phenylserine, (2S,3S)-2-amino-3-hydroxy-3-phenyl-propanoic acid, 98%(HPLC),(mixture of isomers),RG, 98%(HPLC),(mixture of isomers),RG. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
2-amino-3-hydroxy-3-phenylpropanoic acid (CAS 1078-17-7) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-3-hydroxy-3-phenylpropanoic acid. InChIKey: VHVGNTVUSQUXPS-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-3-hydroxy-3-phenylpropanoic acid |
| InChIKey | VHVGNTVUSQUXPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C(=O)O)N)O |
Computed by PubChem (NCBI)