Products 7352-06-9
CAS 7352-06-9 is the registry number for Erythro-D-Phenylserine. Offered by: TRC. Available pack sizes: 100mg.
(2R,3R)-2-amino-3-hydroxy-3-phenylpropanoic acid (CAS 7352-06-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R,3R)-2-amino-3-hydroxy-3-phenylpropanoic acid. InChIKey: VHVGNTVUSQUXPS-HTQZYQBOSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R,3R)-2-amino-3-hydroxy-3-phenylpropanoic acid |
| InChIKey | VHVGNTVUSQUXPS-HTQZYQBOSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)