CAS 109120-55-0 appears in our catalog under these names: D-threo-beta-Phenylserine, (2R,3S)-3-Phenylserine, (2R,3S)-3-Phenylserine, min. 95 %, 50 mg, (2R,3S)-3-Phenylserine, min. 95 %, 100 mg, (2R,3S)-3-Phenylserine, min. 95 %, 250 mg. Offered by: TRC, Biosynth, Roth. Available pack sizes: 1g, 0,05g, 0,1g, 0,25g, 0,5g, 50mg, 100mg, 250mg.
(2R,3S)-2-amino-3-hydroxy-3-phenylpropanoic acid (CAS 109120-55-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R,3S)-2-amino-3-hydroxy-3-phenylpropanoic acid. InChIKey: VHVGNTVUSQUXPS-SFYZADRCSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R,3S)-2-amino-3-hydroxy-3-phenylpropanoic acid |
| InChIKey | VHVGNTVUSQUXPS-SFYZADRCSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)