cas: 240401-10-9 — see every product listed under this CAS number, including other names
ENDO-7-HYDROXY-3-OXA-9-AZABICYCLO[3.3.1]NONANE HCL, 97% (CAS 240401-10-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467719-100MG |
| cas | 240401-10-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol;hydrochloride (CAS 240401-10-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (1R,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol;hydrochloride. InChIKey: CLERARBPHMHUHU-VPEOJXMDSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (1R,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol;hydrochloride |
| InChIKey | CLERARBPHMHUHU-VPEOJXMDSA-N |
| SMILES | C1[C@@H]2COC[C@@H](N2)CC1O.Cl |
Computed by PubChem (NCBI)