cas: 119647-73-3 — see every product listed under this CAS number, including other names
ETHYL 7-OXO-4,5,6,7-TETRAHYDRO-1H-INDOLE-2-CARBOXYLATE, 97% (CAS 119647-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467030-100MG |
| cas | 119647-73-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 500mg | 627.92 Pln | |
| Fluorochem | 1g | 1060.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate (CAS 119647-73-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate. InChIKey: FRUNPDDVIUSYEQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 7-oxo-1,4,5,6-tetrahydroindole-2-carboxylate |
| InChIKey | FRUNPDDVIUSYEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C(=O)CCC2 |
Computed by PubChem (NCBI)