cas: 1397198-81-0 — see every product listed under this CAS number, including other names
ETHYL 8-BROMOIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLATE, 97% (CAS 1397198-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F389763-100MG |
| cas | 1397198-81-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 565.44 Pln | |
| Fluorochem | 250mg | 893.45 Pln | |
| Fluorochem | 500mg | 1445.34 Pln | |
| Fluorochem | 1g | 2132.60 Pln | |
| Fluorochem | 5g | 6250.94 Pln | |
| Fluorochem | 10g | 10358.87 Pln | |
| Fluorochem | 25g | 23401.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS 1397198-81-0) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate. InChIKey: AVXWHMLLGLJWEN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate |
| InChIKey | AVXWHMLLGLJWEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2N1C=CC=C2Br |
Computed by PubChem (NCBI)