cas: 1397198-81-0 — see every product listed under this CAS number, including other names
Ethyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate, 98%, 98% (CAS 1397198-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110W8Z-100mg |
| cas | 1397198-81-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 918.80 Pln | |
| Chemat | 5g | 2637.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS 1397198-81-0) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate. InChIKey: AVXWHMLLGLJWEN-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate |
| InChIKey | AVXWHMLLGLJWEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2N1C=CC=C2Br |
Computed by PubChem (NCBI)