cas: 216753-55-8 — see every product listed under this CAS number, including other names
EXO-8-AZABICYCLO[3.2.1]OCTANE-3-CARBONITRILE HCL, 97% (CAS 216753-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467999-1G |
| cas | 216753-55-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4501.56 Pln | |
| Fluorochem | 5g | 13659.79 Pln | |
| Fluorochem | 10g | 20542.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R,5S)-8-azabicyclo[3.2.1]octane-3-carbonitrile;hydrochloride (CAS 216753-55-8) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: (1R,5S)-8-azabicyclo[3.2.1]octane-3-carbonitrile;hydrochloride. InChIKey: KJBZNGALZBMOCJ-OPZYXJLOSA-N.
| Molecular formula | C8H13ClN2 |
|---|---|
| Molecular weight | 172.65 g/mol |
| IUPAC name | (1R,5S)-8-azabicyclo[3.2.1]octane-3-carbonitrile;hydrochloride |
| InChIKey | KJBZNGALZBMOCJ-OPZYXJLOSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)C#N.Cl |
Computed by PubChem (NCBI)