cas: 216753-55-8 — see every product listed under this CAS number, including other names
exo-8-Azabicyclo(3.2.1)octane-3-carbonitrile hydrochloride, 97% (CAS 216753-55-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A185677-10g |
| cas | 216753-55-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 22282.12 Pln | |
| AmBeed | 5g | 14802.13 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R,5S)-8-azabicyclo[3.2.1]octane-3-carbonitrile;hydrochloride (CAS 216753-55-8) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: (1R,5S)-8-azabicyclo[3.2.1]octane-3-carbonitrile;hydrochloride. InChIKey: KJBZNGALZBMOCJ-OPZYXJLOSA-N.
| Molecular formula | C8H13ClN2 |
|---|---|
| Molecular weight | 172.65 g/mol |
| IUPAC name | (1R,5S)-8-azabicyclo[3.2.1]octane-3-carbonitrile;hydrochloride |
| InChIKey | KJBZNGALZBMOCJ-OPZYXJLOSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)C#N.Cl |
Computed by PubChem (NCBI)