CAS 98206-09-8 appears in our catalog under these names: Eltoprazine hydrochloride, 95%, Eltoprazine hydrochloride/ 99.94% (existing batch purity), Eltoprazine (hydrochloride), 1-(2,3-Dihydrobenzo[b][1,4]dioxin-5-yl)piperazine hydrochloride, ≥99%, ≥99%, Eltoprazine (hydrochloride), 99.25%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 5mg, 10mg, 25mg, 50mg, 500mg, 10mM (in 1ml dmso).
1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine;hydrochloride (CAS 98206-09-8) is a chemical compound with the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine;hydrochloride. InChIKey: JFSOSUNPIXJCIX-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O2 |
|---|---|
| Molecular weight | 256.73 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine;hydrochloride |
| InChIKey | JFSOSUNPIXJCIX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C(=CC=C2)OCCO3.Cl |
Computed by PubChem (NCBI)