cas: 83602-38-4 — see every product listed under this CAS number, including other names
Ethyl (S)-3-Piperidinecarboxylate D-Tartrate, >98.0%(T) (CAS 83602-38-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0681-5G |
| cas | 83602-38-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 516.64 Pln | |
| TCI | 25g | 1716.45 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(3S)-2,3-dihydroxybutanedioic acid;ethyl piperidine-3-carboxylate (CAS 83602-38-4) is a chemical compound with the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. IUPAC name: (3S)-2,3-dihydroxybutanedioic acid;ethyl piperidine-3-carboxylate. InChIKey: HHPGQKZOPPDLNH-FWQMQHHGSA-N.
| Molecular formula | C12H21NO8 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (3S)-2,3-dihydroxybutanedioic acid;ethyl piperidine-3-carboxylate |
| InChIKey | HHPGQKZOPPDLNH-FWQMQHHGSA-N |
| SMILES | CCOC(=O)C1CCCNC1.[C@H](C(C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)