cas: 83602-38-4 — see every product listed under this CAS number, including other names
Ethyl (S)-3-Piperidinecarboxylate L-tartrate, 97% (CAS 83602-38-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1163395-25g |
| cas | 83602-38-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 3364.06 Pln | |
| AmBeed | 1g | 402.01 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-2,3-dihydroxybutanedioic acid;ethyl piperidine-3-carboxylate (CAS 83602-38-4) is a chemical compound with the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. IUPAC name: (3S)-2,3-dihydroxybutanedioic acid;ethyl piperidine-3-carboxylate. InChIKey: HHPGQKZOPPDLNH-FWQMQHHGSA-N.
| Molecular formula | C12H21NO8 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (3S)-2,3-dihydroxybutanedioic acid;ethyl piperidine-3-carboxylate |
| InChIKey | HHPGQKZOPPDLNH-FWQMQHHGSA-N |
| SMILES | CCOC(=O)C1CCCNC1.[C@H](C(C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)