cas: 1245772-15-9 — see every product listed under this CAS number, including other names
Ethyl 1-(1-methylethyl)-3-nitro-1H-pyrazole-5-carboxylate, 97%, 97% (CAS 1245772-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AOBU-100mg |
| cas | 1245772-15-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 500mg | 578.00 Pln | |
| Chemat | 1g | 938.00 Pln | |
| Chemat | 5g | 3131.60 Pln | |
| Chemat | 10g | 5411.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-nitro-1-propan-2-ylpyrazole-5-carboxylate (CAS 1245772-15-9) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: ethyl 3-nitro-1-propan-2-ylpyrazole-5-carboxylate. InChIKey: RDHJKLXWZBJJNM-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | ethyl 3-nitro-1-propan-2-ylpyrazole-5-carboxylate |
| InChIKey | RDHJKLXWZBJJNM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1C(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)