cas: 773134-84-2 — see every product listed under this CAS number, including other names
Ethyl 1-bromo-2-naphthoate, 97% (CAS 773134-84-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545203-5G |
| cas | 773134-84-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Fluorochem | 25g | 825.77 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 1-bromonaphthalene-2-carboxylate (CAS 773134-84-2) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 1-bromonaphthalene-2-carboxylate. InChIKey: TXDQMAGPAKABJU-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | ethyl 1-bromonaphthalene-2-carboxylate |
| InChIKey | TXDQMAGPAKABJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2C=C1)Br |
Computed by PubChem (NCBI)