cas: 40674-21-3 — see every product listed under this CAS number, including other names
Ethyl 2-((1,3-dioxoisoindolin-2-yl)oxy)-2-methylpropanoate 98% (CAS 40674-21-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1242916-10g |
| cas | 40674-21-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 570.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1242916 |
Ethyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate (CAS 40674-21-3) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: ethyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate. InChIKey: UNZUMKCIIIFEJI-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | ethyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate |
| InChIKey | UNZUMKCIIIFEJI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)