cas: 40674-21-3 — see every product listed under this CAS number, including other names
Ethyl 2-((1,3-dioxoisoindolin-2-yl)oxy)-2-methylpropanoate, 98%, 98% (CAS 40674-21-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1186MD-250mg |
| cas | 40674-21-3 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 491.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate (CAS 40674-21-3) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: ethyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate. InChIKey: UNZUMKCIIIFEJI-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | ethyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate |
| InChIKey | UNZUMKCIIIFEJI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)