cas: 1813-94-1 — see every product listed under this CAS number, including other names
Ethyl 2-(4-fluorophenyl)-2-oxoacetate 98% (CAS 1813-94-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A560433-1g |
| cas | 1813-94-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 921.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A560433 |
Ethyl 2-(4-fluorophenyl)-2-oxoacetate (CAS 1813-94-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: ethyl 2-(4-fluorophenyl)-2-oxoacetate. InChIKey: RFKIEIUHZZILBI-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | ethyl 2-(4-fluorophenyl)-2-oxoacetate |
| InChIKey | RFKIEIUHZZILBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)