cas: 50845-77-7 — see every product listed under this CAS number, including other names
Ethyl 2-[(4-methoxyphenyl)amino]acetate 98% (CAS 50845-77-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A355320-250mg |
| cas | 50845-77-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1343.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A355320 |
Ethyl 2-(4-methoxyanilino)acetate (CAS 50845-77-7) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: ethyl 2-(4-methoxyanilino)acetate. InChIKey: TZJRPKDPYLAMJZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | ethyl 2-(4-methoxyanilino)acetate |
| InChIKey | TZJRPKDPYLAMJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)