cas: 50845-77-7 — see every product listed under this CAS number, including other names
Ethyl 2-[(4-methoxyphenyl)amino]acetate, 97%, 97% (CAS 50845-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKLR-100mg |
| cas | 50845-77-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1101.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4-methoxyanilino)acetate (CAS 50845-77-7) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: ethyl 2-(4-methoxyanilino)acetate. InChIKey: TZJRPKDPYLAMJZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | ethyl 2-(4-methoxyanilino)acetate |
| InChIKey | TZJRPKDPYLAMJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)