cas: 99073-88-8 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-6-benzothiazolecarboxylate, 95% (CAS 99073-88-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079995-1G |
| cas | 99073-88-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 575.86 Pln | |
| Fluorochem | 25g | 1299.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-bromo-1,3-benzothiazole-6-carboxylate (CAS 99073-88-8) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: ethyl 2-bromo-1,3-benzothiazole-6-carboxylate. InChIKey: JQZQKEZCRZNJPC-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | ethyl 2-bromo-1,3-benzothiazole-6-carboxylate |
| InChIKey | JQZQKEZCRZNJPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)