cas: 99073-88-8 — see every product listed under this CAS number, including other names
Ethyl 2-bromobenzo[d]thiazole-6-carboxylate, 97%, 97% (CAS 99073-88-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116T99-100mg |
| cas | 99073-88-8 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 256.40 Pln | |
| Chemat | 10g | 448.40 Pln | |
| Chemat | 25g | 938.00 Pln | |
| Chemat | 100g | 3482.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-bromo-1,3-benzothiazole-6-carboxylate (CAS 99073-88-8) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: ethyl 2-bromo-1,3-benzothiazole-6-carboxylate. InChIKey: JQZQKEZCRZNJPC-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | ethyl 2-bromo-1,3-benzothiazole-6-carboxylate |
| InChIKey | JQZQKEZCRZNJPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)