cas: 70180-38-0 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-4,6-dihydroxynicotinate (CAS 70180-38-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447006-1G |
| cas | 70180-38-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2137.81 Pln | |
| Fluorochem | 5g | 7370.34 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 2-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate (CAS 70180-38-0) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: ethyl 2-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate. InChIKey: XAMKYZWQQAAKRH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | ethyl 2-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | XAMKYZWQQAAKRH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=O)C=C1O)Cl |
Computed by PubChem (NCBI)