cas: 70180-38-0 — see every product listed under this CAS number, including other names
2-Chloro-4,6-dihydroxypyridine-3-carboxaylic acid ethyl ester, ≥95%, ≥95% (CAS 70180-38-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q4O-1g |
| cas | 70180-38-0 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1307.60 Pln | |
| Chemat | 5g | 4466.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate (CAS 70180-38-0) is a chemical compound with the molecular formula C8H8ClNO4 and a molecular weight of 217.60 g/mol. IUPAC name: ethyl 2-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate. InChIKey: XAMKYZWQQAAKRH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | ethyl 2-chloro-4-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | XAMKYZWQQAAKRH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=O)C=C1O)Cl |
Computed by PubChem (NCBI)