cas: 139911-30-1 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-5-fluoronicotinate, 98%, 98% (CAS 139911-30-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110AI6-250mg |
| cas | 139911-30-1 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 500mg | 184.40 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 549.20 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1562.00 Pln | |
| Chemat | 50g | 2858.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-chloro-5-fluoropyridine-3-carboxylate (CAS 139911-30-1) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: ethyl 2-chloro-5-fluoropyridine-3-carboxylate. InChIKey: ZCQJBYHGMYTQAO-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | ethyl 2-chloro-5-fluoropyridine-3-carboxylate |
| InChIKey | ZCQJBYHGMYTQAO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)F)Cl |
Computed by PubChem (NCBI)