cas: 15795-20-7 — see every product listed under this CAS number, including other names
Ethyl 3-(4-bromophenyl)acrylate 96% (E) (CAS 15795-20-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A601653-1g |
| cas | 15795-20-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 348.12 Pln | |
| Ambeed | 10g | 565.06 Pln | |
| Ambeed | 25g | 1065.69 Pln | |
| Ambeed | 100g | 3563.25 Pln |
| purity | 96% (E) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A601653 |
Ethyl 3-(4-bromophenyl)prop-2-enoate (CAS 15795-20-7) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: ethyl 3-(4-bromophenyl)prop-2-enoate. InChIKey: YOOKYIPLSLPRTC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | ethyl 3-(4-bromophenyl)prop-2-enoate |
| InChIKey | YOOKYIPLSLPRTC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)