cas: 838-57-3 — see every product listed under this CAS number, including other names
Ethyl 3-(4-nitrophenyl)-3-oxopropanoate, 95% (CAS 838-57-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337059-1G |
| cas | 838-57-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 268.67 Pln | |
| Fluorochem | 25g | 476.93 Pln | |
| Fluorochem | 100g | 1736.91 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-(4-nitrophenyl)-3-oxopropanoate (CAS 838-57-3) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: ethyl 3-(4-nitrophenyl)-3-oxopropanoate. InChIKey: NGRXSVFCLHVGKU-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | ethyl 3-(4-nitrophenyl)-3-oxopropanoate |
| InChIKey | NGRXSVFCLHVGKU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)