cas: 168473-88-9 — see every product listed under this CAS number, including other names
Ethyl 3-amino-4-bromobenzoate 98% (CAS 168473-88-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A304908-250mg |
| cas | 168473-88-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1405.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A304908 |
Ethyl 3-amino-4-bromobenzoate (CAS 168473-88-9) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 3-amino-4-bromobenzoate. InChIKey: PPVXNRMIVXWQKP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 3-amino-4-bromobenzoate |
| InChIKey | PPVXNRMIVXWQKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Br)N |
Computed by PubChem (NCBI)