cas: 143982-54-1 — see every product listed under this CAS number, including other names
Ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate 97% (CAS 143982-54-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143905-250mg |
| cas | 143982-54-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 25g | 1705.38 Pln | |
| Ambeed | 100g | 4970.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143905 |
Ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS 143982-54-1) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: MPILHKPXTMEIMG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 3-bromoimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | MPILHKPXTMEIMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C=CC=CC2=N1)Br |
Computed by PubChem (NCBI)