cas: 204863-53-6 — see every product listed under this CAS number, including other names
Ethyl 3-oxo-3,4-dihydro-2H-benzo(b)(1,4)thiazine-6-carboxylate, 95+% (CAS 204863-53-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A671620-5g |
| cas | 204863-53-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5994.10 Pln | |
| AmBeed | 10g | 7237.51 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate (CAS 204863-53-6) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: ethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate. InChIKey: ANIBMWZLVBRBFZ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | ethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| InChIKey | ANIBMWZLVBRBFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)SCC(=O)N2 |
Computed by PubChem (NCBI)